Introduction：Basic information about CAS 42580-42-7|2,5-Bis(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Bis(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 42580-42-7 | Molecular Weight | 258.11700 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 55.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H4F6O2 | Melting Point | 78-80 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,5-Bis(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 55.2ºC at 760mmHg |
|---|
| Melting Point | 78-80 °C(lit.) |
|---|
| Molecular Formula | C9H4F6O2 |
|---|
| Molecular Weight | 258.11700 |
|---|
| Exact Mass | 258.01200 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.42240 |
|---|
| Index of Refraction | 1.424 |
|---|
| InChIKey | PINBPLCVZSKLTF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,5-Bis(Trifluoromethyl)Benzoic Acid |
| 2,4-DICHLORO-5-NITRO-6-METHYLPYRIMIDINE |
| MFCD00013249 |
