Introduction：Basic information about CAS 20191-74-6|2-Ethyl-5-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Ethyl-5-nitroaniline |
|---|
| CAS Number | 20191-74-6 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 335.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.6±22.3 °C |
|---|
Names
| Name | 2-ethyl-5-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 335.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 156.6±22.3 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.36 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | MMZWMCKTKJKIMC-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc([N+](=O)[O-])cc1N |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Ethyl-5-nitrobenzenamine |
| ZR B2 ENW |
| 4-Nitro-2-amino-1-aethyl-benzol |
| Benzenamine, 2-ethyl-5-nitro- |
| 2-ethyl-5-nitro-benzenamine |
| 2-ethyl-5-nitrophenylamine |
| 2-ethyl-5-nitro-aniline |
| 2-Ethyl-5-nitroaniline |
| Benzenamine,2-ethyl-5-nitro |
| 2-Aethyl-5-nitro-anilin |
