Introduction：Basic information about CAS 870703-51-8|2,5-Diethoxybenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Diethoxybenzoyl chloride |
|---|
| CAS Number | 870703-51-8 | Molecular Weight | 228.67200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H13ClO3 | Melting Point | 46-50ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 110ºC |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2,5-Diethoxybenzoyl chloride |
|---|
Chemical & Physical Properties
| Melting Point | 46-50ºC(lit.) |
|---|
| Molecular Formula | C11H13ClO3 |
|---|
| Molecular Weight | 228.67200 |
|---|
| Flash Point | 110ºC |
|---|
| Exact Mass | 228.05500 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.86300 |
|---|
| InChIKey | SRINATMKXDIOTA-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(OCC)c(C(=O)Cl)c1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 1759 8/PG 3 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
