Introduction:Basic information about CAS 95192-58-8|4-iodo-2,6-dinitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-iodo-2,6-dinitrobenzoic acid |
|---|
| CAS Number | 95192-58-8 | Molecular Weight | 338.013 |
|---|
| Density | 2.3±0.1 g/cm3 | Boiling Point | 434.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3IN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.6±28.7 °C |
|---|
Names
| Name | 4-iodo-2,6-dinitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.3±0.1 g/cm3 |
|---|
| Boiling Point | 434.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3IN2O6 |
|---|
| Molecular Weight | 338.013 |
|---|
| Flash Point | 216.6±28.7 °C |
|---|
| Exact Mass | 337.903564 |
|---|
| PSA | 128.94000 |
|---|
| LogP | 2.20 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.734 |
|---|
| InChIKey | ICBYGRQHOGFPOM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c([N+](=O)[O-])cc(I)cc1[N+](=O)[O-] |
|---|
Synonyms
| 2,6-Dinitro-4-iodobenzoic acid |
| Benzoic acid, 4-iodo-2,6-dinitro- |
| 4-Iodo-2,6-dinitrobenzoic acid |