Introduction：Basic information about CAS 95192-60-2|2-Bromo-4,6-dinitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-4,6-dinitrobenzoic acid |
|---|
| CAS Number | 95192-60-2 | Molecular Weight | 291.01300 |
|---|
| Density | 2.051g/cm3 | Boiling Point | 419ºC at 760mmHg |
|---|
| Molecular Formula | C7H3BrN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.2ºC |
|---|
Names
| Name | 2-Bromo-4,6-dinitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.051g/cm3 |
|---|
| Boiling Point | 419ºC at 760mmHg |
|---|
| Molecular Formula | C7H3BrN2O6 |
|---|
| Molecular Weight | 291.01300 |
|---|
| Flash Point | 207.2ºC |
|---|
| Exact Mass | 289.91700 |
|---|
| PSA | 128.94000 |
|---|
| LogP | 3.01010 |
|---|
| Index of Refraction | 1.685 |
|---|
| InChIKey | QFPZAEXSGILFAI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Synonyms
| 2-Brom-4,6-dinitro-benzoesaeure |
| 2-bromo-4,6-dinitro-benzoic acid |
