Introduction:Basic information about CAS 95192-61-3|2-Chloro-4,6-dinitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4,6-dinitrobenzoic acid |
|---|
| CAS Number | 95192-61-3 | Molecular Weight | 246.56200 |
|---|
| Density | 1.791g/cm3 | Boiling Point | 400.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H3ClN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.8ºC |
|---|
Names
| Name | 2-Chloro-4,6-dinitrobenzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.791g/cm3 |
|---|
| Boiling Point | 400.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H3ClN2O6 |
|---|
| Molecular Weight | 246.56200 |
|---|
| Flash Point | 195.8ºC |
|---|
| Exact Mass | 245.96800 |
|---|
| PSA | 128.94000 |
|---|
| LogP | 2.90100 |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | QBIQLTOUDBEJCV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|