Introduction:Basic information about CAS 95192-59-9|4-Methoxy-2,6-dinitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methoxy-2,6-dinitrobenzoic acid |
|---|
| CAS Number | 95192-59-9 | Molecular Weight | 242.14200 |
|---|
| Density | 1.618g/cm3 | Boiling Point | 436.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.7ºC |
|---|
Names
| Name | 4-Methoxy-2,6-dinitrobenzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.618g/cm3 |
|---|
| Boiling Point | 436.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N2O7 |
|---|
| Molecular Weight | 242.14200 |
|---|
| Flash Point | 217.7ºC |
|---|
| Exact Mass | 242.01800 |
|---|
| PSA | 138.17000 |
|---|
| LogP | 2.25620 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | DHLQYRJLNSXMPW-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c(C(=O)O)c([N+](=O)[O-])c1 |
|---|