Introduction：Basic information about CAS 55474-40-3|2-(4-chlorophenyl)-3-oxovaleronitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-chlorophenyl)-3-oxovaleronitrile |
|---|
| CAS Number | 55474-40-3 | Molecular Weight | 207.65600 |
|---|
| Density | 1.186g/cm3 | Boiling Point | 291.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.9ºC |
|---|
Names
| Name | 2-(4-chlorophenyl)-3-oxopentanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.186g/cm3 |
|---|
| Boiling Point | 291.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO |
|---|
| Molecular Weight | 207.65600 |
|---|
| Flash Point | 129.9ºC |
|---|
| Exact Mass | 207.04500 |
|---|
| PSA | 40.86000 |
|---|
| LogP | 2.92628 |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | NKRGJBDEEGULAN-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)C(C#N)c1ccc(Cl)cc1 |
|---|
Synonyms
| 2-(4-Chlor-phenyl)-3-oxo-valeronitril |
| EINECS 259-656-3 |
| Alpha-(4-Chlorophenyl)-Alpha-propionylacetonitrile |
| 1-(4-Chlor-phenyl)-1-cyan-butanon-(2) |
| 2-(4-Chlorophenyl)-3-oxovaleronitrile |
| 1-(4-chlorophenyl)-1-cyanobutan-2-one |
