Introduction：Basic information about CAS 117724-64-8|2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl chloride |
|---|
| CAS Number | 117724-64-8 | Molecular Weight | 229.60700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H3ClF3NOS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H3ClF3NOS |
|---|
| Molecular Weight | 229.60700 |
|---|
| Exact Mass | 228.95800 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 2.84930 |
|---|
| InChIKey | WNJINNZMSVNKJD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)Cl)s1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 5-chlorocarbonyl-2-methyl-4-trifluoromethylthiazole |
| 2-methyl-4-trifluoromethyl-5-chlorocarbonyl thiazole |
| 2-methyl-4-trifluoromethyl-thiazole-5-carboxylic chloride |
| 2-methyl-4-trifluoromethylthiazole-5-carbonyl chloride |
