Introduction：Basic information about CAS 121-58-4|Benzenesulfonic acid,4-(dimethylamino)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-(dimethylamino)- |
|---|
| CAS Number | 121-58-4 | Molecular Weight | 201.24300 |
|---|
| Density | 1.339g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H11NO3S | Melting Point | 270.5°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(dimethylamino)benzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.339g/cm3 |
|---|
| Melting Point | 270.5°C |
|---|
| Molecular Formula | C8H11NO3S |
|---|
| Molecular Weight | 201.24300 |
|---|
| Exact Mass | 201.04600 |
|---|
| PSA | 65.99000 |
|---|
| LogP | 2.08010 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | KZVBBVPCVQEVQK-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc(S(=O)(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N,N-Dimethyl-sulfanilsaeure |
| Sulfanilic acid,N-dimethyl |
| p-N,N-dimethylaminobenzenesulfonic acid |
| EINECS 204-483-0 |
| 4-dimethylaminobenzenesulfonic acid |
| N,N-Dimethylsulfanilic acid |
