Introduction:Basic information about CAS 190906-92-4|1-boc-2-methyl-piperidin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-boc-2-methyl-piperidin-4-one |
|---|
| CAS Number | 190906-92-4 | Molecular Weight | 213.273 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 298.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.5±25.4 °C |
|---|
Names
| Name | tert-butyl 2-methyl-4-oxopiperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 298.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H19NO3 |
|---|
| Molecular Weight | 213.273 |
|---|
| Flash Point | 134.5±25.4 °C |
|---|
| Exact Mass | 213.136490 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 0.88 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.471 |
|---|
| InChIKey | HQMYWQCBINPHBB-UHFFFAOYSA-N |
|---|
| SMILES | CC1CC(=O)CCN1C(=O)OC(C)(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD04035608 |
| N-Boc-(+/-)-2-methyl-4-piperidone |
| 2-methyl-4-oxopiperidine,n-boc protected |
| 1-(tert-butoxycarbonyl)-2-methyl-4-oxopiperidine |
| 1-boc-2-methyl-piperidin-4-one |
| 2-methyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester |
| 1-(tert-butoxycarbonyl)-2-methylpiperidin-4-one |
| 1-n-boc-2-methylpiperidin-4-one |
| 1-Boc-2-methyl-4-piperidinone |
| 1-t-butoxycarbonyl-2-methyl-4-piperidone |
| N-Boc-2-Methylpiperidone |
| N-(t-butyloxycarbonyl)-2-methyl-4-piperidone |