Introduction：Basic information about CAS 5443-33-4|Acetamide, N-(5-chloro-2-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide, N-(5-chloro-2-nitrophenyl)- |
|---|
| CAS Number | 5443-33-4 | Molecular Weight | 214.60600 |
|---|
| Density | 1.466g/cm3 | Boiling Point | 405.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H7ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.1ºC |
|---|
Names
| Name | N-(5-chloro-2-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.466g/cm3 |
|---|
| Boiling Point | 405.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H7ClN2O3 |
|---|
| Molecular Weight | 214.60600 |
|---|
| Flash Point | 199.1ºC |
|---|
| Exact Mass | 214.01500 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 2.80280 |
|---|
| InChIKey | YWANGSCDWBUSBK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cc(Cl)ccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-acetamido-4-chloro-1-nitrobenzene |
| N-acetyl-5-chloro-2-nitroaniline |
| Essigsaeure-(5-chlor-2-nitro-anilid) |
| acetic acid-(5-chloro-2-nitro-anilide) |
| 5-Chlor-2-nitro-acetanilid |
| 5-Chloro-2-nitroacetanilide |
