Introduction:Basic information about CAS 15880-03-2|Benzenebutanoic acid,2,4-dimethyl-g-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenebutanoic acid,2,4-dimethyl-g-oxo- |
|---|
| CAS Number | 15880-03-2 | Molecular Weight | 206.23800 |
|---|
| Density | 1.138g/cm3 | Boiling Point | 389.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.6ºC |
|---|
Names
| Name | 4-(2,4-dimethylphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.138g/cm3 |
|---|
| Boiling Point | 389.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O3 |
|---|
| Molecular Weight | 206.23800 |
|---|
| Flash Point | 203.6ºC |
|---|
| Exact Mass | 206.09400 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.35090 |
|---|
| Vapour Pressure | 9.1E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | JYLUOTCHTVZCDL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)CCC(=O)O)c(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-(2,4-Dimethyl-phenyl)-4-oxo-buttersaeure |
| 3-Oxo-3-(2.4-dimethyl-phenyl)-propan-carbonsaeure-(1) |
| 4-oxo-4-(2,4-dimethylphenyl)butanoic acid |
| 4-Oxo-4-[2.4]xylyl-buttersaeure |
| 3-(2,4-Dimethylbenzoyl)-propionic acid |
| 4-(2,4-Dimethyl-phenyl)-4-oxo-butyric acid |