Introduction:Basic information about CAS 14737-80-5|N-Methyltetrachlorophthalimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Methyltetrachlorophthalimide |
|---|
| CAS Number | 14737-80-5 | Molecular Weight | 298.938 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 433.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H3Cl4NO2 | Melting Point | 273-275ºC |
|---|
| MSDS | / | Flash Point | 215.7±28.7 °C |
|---|
Names
| Name | 4,5,6,7-tetrachloro-2-methylisoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 433.1±45.0 °C at 760 mmHg |
|---|
| Melting Point | 273-275ºC |
|---|
| Molecular Formula | C9H3Cl4NO2 |
|---|
| Molecular Weight | 298.938 |
|---|
| Flash Point | 215.7±28.7 °C |
|---|
| Exact Mass | 296.891785 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 3.51 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | OHCSZUQRNNNMRG-UHFFFAOYSA-N |
|---|
| SMILES | CN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4,5,6,7-tetrachloro-2-methyl-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrachloro-2-methyl- |
| tetrachloro-N-methylphthalimide |
| 3,4,5,6-Tetrachlor-N-methylphthalimid |
| EINECS 238-799-5 |
| N-Methyl-3,4,5,6-tetrachlorophthalimide |
| 4,5,6,7-tetrachloro-2-methyl-isoindoline-1,3-dione |
| N-Methyltetrachlorophthalimide |
| N-methyl-tetrachlorophthalimide |
| MFCD07368041 |
| 4,5,6,7-Tetrachloro-2-methyl-1H-isoindole-1,3(2H)-dione |
| 4,5,6,7-Tetrachlor-2-methyl-isoindolin-1,3-dion |
| 3,4,5,6-tetrachloro-N-methylphthalimide |