Introduction：Basic information about CAS 85903-25-9|1-pyridin-4-yl-3-thiophen-2-yl-propane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-pyridin-4-yl-3-thiophen-2-yl-propane-1,3-dione |
|---|
| CAS Number | 85903-25-9 | Molecular Weight | 231.27000 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 434.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.4ºC |
|---|
Names
| Name | 1-pyridin-4-yl-3-thiophen-2-ylpropane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 434.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2S |
|---|
| Molecular Weight | 231.27000 |
|---|
| Flash Point | 216.4ºC |
|---|
| Exact Mass | 231.03500 |
|---|
| PSA | 75.27000 |
|---|
| LogP | 2.59880 |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | FFHNDRMNLBJSHI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)c1cccs1)c1ccncc1 |
|---|
Synonyms
| 1-pyridin-4-yl-3-thiophen-2-yl-propane-1,3-dione |
| Isonicotinoylthenoylmethan |
| HMS3080L19 |
| 1-[4]Pyridyl-3-[2]thienyl-propan-1,3-dion |
| 1-[4]pyridyl-3-[2]thienyl-propane-1,3-dione |
