Introduction：Basic information about CAS 5714-08-9|D-Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo- |
|---|
| CAS Number | 5714-08-9 | Molecular Weight | 650.97300 |
|---|
| Density | 2.387g/cm3 | Boiling Point | 563.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12I3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 294.6ºC |
|---|
Names
| Name | D-Alanine, 3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.387g/cm3 |
|---|
| Boiling Point | 563.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12I3NO4 |
|---|
| Molecular Weight | 650.97300 |
|---|
| Flash Point | 294.6ºC |
|---|
| Exact Mass | 650.79000 |
|---|
| PSA | 92.78000 |
|---|
| LogP | 4.65300 |
|---|
| Index of Refraction | 1.763 |
|---|
| InChIKey | AUYYCJSJGJYCDS-GFCCVEGCSA-N |
|---|
| SMILES | NC(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
|---|
Synonyms
| D-Triiodothyronine |
| 3,5,3'-D-Triiodothyronine |
| Alanine,3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-,D-(8CI) |
| Dextrotriiodothyronine |
| D-Triiodothyronin |
| D-3,5,3'-Triiodothyronine |
| D-Tyrosine,O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-(9CI) |
