Introduction：Basic information about CAS 6843-89-6|1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester |
|---|
| CAS Number | 6843-89-6 | Molecular Weight | 232.23200 |
|---|
| Density | 1.328g/cm3 | Boiling Point | 375.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144ºC |
|---|
Names
| Name | ethyl 1,3-dihydroxynaphthalene-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.328g/cm3 |
|---|
| Boiling Point | 375.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O4 |
|---|
| Molecular Weight | 232.23200 |
|---|
| Flash Point | 144ºC |
|---|
| Exact Mass | 232.07400 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.42770 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | JNVQTZHEEIATCI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c(O)cc2ccccc2c1O |
|---|
Safety Information
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Naphthoresorcin-carbonsaeure-(2)-ethylester |
| 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester |
| ethyl 1,3-dihydroxy-2-naphthoate |
| 1,3-Dihydroxy-naphthalin-carbonsaeure-(2)-ethylester |
| 1,3-Dihydroxy-[2]naphthoesaeure-aethylester |
| ethyl 1,3-dihydroxynaphthoate |
| F0118-0027 |
| 1,3-dihydroxy-[2]naphthoic acid ethyl ester |
| 1,3-dihydroxy-naphthalene-2-carboxylic acid ethyl ester |
