Introduction：Basic information about CAS 2628-87-7|2-Phenylglutaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Phenylglutaric acid |
|---|
| CAS Number | 2628-87-7 | Molecular Weight | 208.21100 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 362.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.3ºC |
|---|
Names
| Name | 2-phenylpentanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 362.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 |
|---|
| Molecular Weight | 208.21100 |
|---|
| Flash Point | 187.3ºC |
|---|
| Exact Mass | 208.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.71960 |
|---|
| Vapour Pressure | 6.79E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | GOEBEEJCYYXSFT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(C(=O)O)c1ccccc1 |
|---|
Synonyms
| 3-phenylglutaric acid |
| Pentanedioic acid,2-phenyl |
| 2-phenyl-pentanedioic acid |
| 2-Phenylglutaric acid |
