Introduction：Basic information about CAS 67202-81-7|Aceticacid, 2-[4-(acetylamino)phenoxy]-,ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Aceticacid, 2-[4-(acetylamino)phenoxy]-,ethyl ester |
|---|
| CAS Number | 67202-81-7 | Molecular Weight | 237.25200 |
|---|
| Density | 1.189g/cm3 | Boiling Point | 416.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.8ºC |
|---|
Names
| Name | ethyl 2-(4-acetamidophenoxy)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.189g/cm3 |
|---|
| Boiling Point | 416.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO4 |
|---|
| Molecular Weight | 237.25200 |
|---|
| Flash Point | 205.8ºC |
|---|
| Exact Mass | 237.10000 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 1.65990 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | HRTRDUZXXPCTOO-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)COc1ccc(NC(C)=O)cc1 |
|---|
Synonyms
| 4-Acetamino-phenoxyessigsaeure-aethylester |
| CCG-732 |
