Introduction：Basic information about CAS 35642-64-9|Reactive Orange 12, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Reactive Orange 12 |
|---|
| CAS Number | 35642-64-9 | Molecular Weight | 674.04300 |
|---|
| Density | 2.07 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C20H16ClN9O10S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Reactive Orange 12 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.07 g/cm3 |
|---|
| Molecular Formula | C20H16ClN9O10S3 |
|---|
| Molecular Weight | 674.04300 |
|---|
| Exact Mass | 672.98700 |
|---|
| PSA | 344.81000 |
|---|
| LogP | 7.32000 |
|---|
| Index of Refraction | 1.863 |
|---|
| InChIKey | GFPPLTJOYVDEIS-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)Nc1cc(Nc2nc(N)nc(Cl)n2)ccc1N=Nc1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
|---|
Synonyms
| 7-[[2-[(Aminocarbonyl)amino]-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]azo]-1,3,6-naphthalenetrisulfonic acid |
| 7-[4-[(4-Amino-6-chloro-1,3,5-triazine-2-yl)amino]-2-(aminocarbonylamino)phenylazo]naphthalene-1,3,6-trisulfonic acid |
