Introduction：Basic information about CAS 1174020-40-6|tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
|---|
| CAS Number | 1174020-40-6 | Molecular Weight | 219.253 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 300.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H18FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.7±27.9 °C |
|---|
Names
| Name | (3S,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 300.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H18FNO3 |
|---|
| Molecular Weight | 219.253 |
|---|
| Flash Point | 135.7±27.9 °C |
|---|
| Exact Mass | 219.127075 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 0.57 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.478 |
|---|
| InChIKey | XRNLYXKYODGLMI-JGVFFNPUSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C(F)C1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Methyl-2-propanyl (3S,4R)-3-fluoro-4-hydroxy-1-piperidinecarboxylate |
| (3S,4R)-N-t-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid |
| 1-Boc-3S-fluoro-4R-piperidinol |
| 1-Piperidinecarboxylic acid, 3-fluoro-4-hydroxy-, 1,1-dimethylethyl ester, (3S,4R)- |
| 1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid |
| (3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)-pyrrolidine-3-carboxylic acid |
| tert-butyl cis-3-fluoro-4-hydroxy-piperidine-1-carboxylate |
| (3S,4R)-N-tert-butyl-4-(2,4-difluoro-phenyl)-pyrrolidine-3-carboxylic acid |
| (cis)-3-fluoro-4-hydroxypiperidine-1-carboxylic acid tert-butyl ester |
| (3S,4R)-1-t-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid |
| tert-butyl (3,4-cis)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
