Introduction：Basic information about CAS 268542-15-0|3-((tert-Butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-((tert-Butoxycarbonyl)amino)-3-(naphthalen-2-yl)propanoic acid |
|---|
| CAS Number | 268542-15-0 | Molecular Weight | 315.364 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 508.9±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261.6±28.2 °C |
|---|
Names
| Name | Boc-(R,S)-3-amino-3-(2-naphthyl)-proponic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 508.9±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H21NO4 |
|---|
| Molecular Weight | 315.364 |
|---|
| Flash Point | 261.6±28.2 °C |
|---|
| Exact Mass | 315.147064 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.95 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | NCQJBPXXRXOIJD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1ccc2ccccc2c1 |
|---|
Synonyms
| 3-tert-Butoxycarbonylamino-3-naphthalen-2-yl-propionic acid |
| 3-[(tert-Butoxycarbonyl)amino]-3-(2-naphthyl)propanoic acid |
| 2-Naphthalenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(2-naphthyl)propanoic acid |
| 2-Naphthalenepropanoicacid, b-[[(1,1-dimethylethoxy)carbonyl]amino]- |
