Introduction：Basic information about CAS 80285-16-1|trans-2-(4-Cyanophenyl)-5-n-propyl-1,3-dioxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trans-2-(4-Cyanophenyl)-5-n-propyl-1,3-dioxane |
|---|
| CAS Number | 80285-16-1 | Molecular Weight | 231.29000 |
|---|
| Density | 1.1 g/cm3 | Boiling Point | 366.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 | Melting Point | 58-60ºC |
|---|
| MSDS | / | Flash Point | 132.7ºC |
|---|
Names
| Name | 2-(4-cyanophenyl)-5-n-propyl-1,3-dioxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1 g/cm3 |
|---|
| Boiling Point | 366.3ºC at 760 mmHg |
|---|
| Melting Point | 58-60ºC |
|---|
| Molecular Formula | C14H17NO2 |
|---|
| Molecular Weight | 231.29000 |
|---|
| Flash Point | 132.7ºC |
|---|
| Exact Mass | 231.12600 |
|---|
| PSA | 42.25000 |
|---|
| LogP | 3.01998 |
|---|
| InChIKey | GQPFCPRCGONDNN-UHFFFAOYSA-N |
|---|
| SMILES | CCCC1COC(c2ccc(C#N)cc2)OC1 |
|---|
Safety Information
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 22-36/37/39 |
|---|
| RIDADR | UN3439 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(5-Pentyl-pyridin-2-yl)-benzonitrile |
| 4-pentyl-4'-cyanophenylpyridine |
| MFCD00799426 |
| 2-(2-HYDROXYETHYLAMINO)-6-(ISOPENT-2-ENYLAMINO)-9-METHYLPURINE |
| 2-p-cyanophenyl-5-pentylpyridine |
| 2-p-cyanophenyl-5-propyl-1,3-dioxane |
| EINECS 279-441-8 |
| 5-pentyl-2-(4-cyanophenyl)pyridine |
| 5-amyl-2-(4-cyanophenyl)pyridine |
| 4-(5-propyl-1,3-dioxan-2-yl)benzonitrile |
