Introduction：Basic information about CAS 80404-14-4|4-Oxo-TEMPO-d16,15N,free radica, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Oxo-TEMPO-d16,15N,free radica |
|---|
| CAS Number | 80404-14-4 | Molecular Weight | 187.32100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9D16NO2 | Melting Point | 35ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | 1-λ1-oxidanyl-2,2,6,6-tetramethylpiperidin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 35ºC(lit.) |
|---|
| Molecular Formula | C9D16NO2 |
|---|
| Molecular Weight | 187.32100 |
|---|
| Exact Mass | 187.21600 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 1.49190 |
|---|
| InChIKey | WSGDRFHJFJRSFY-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC(=O)CC(C)(C)N1[O] |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Oxo-2,2,6,6-tetramethylpiperidine-d16,1-15N-1-oxyl |
| 4-oxo-2,2,6,6-tetra((2)H3)methyl-1-(3,3,5,5-(2)H4,1-(15)N)piperidinyloxyl |
| 4-oxo-2,2,6,6-tetramethylpiperidine-d16 |
| 4-Oxo-TEMPO-d16,1-15N,free radical |
| TEMPONE-1-15N |
| TEMPONE-d16,1-15N |
| 1-15N-1-oxyl |
| MFCD00190575 |
| 4-Oxo-TEMPO-1-15N |
