Introduction：Basic information about CAS 19692-24-1|4-ETHOXY-1-NAPHTHOIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-ETHOXY-1-NAPHTHOIC ACID |
|---|
| CAS Number | 19692-24-1 | Molecular Weight | 259.256 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 447.8±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.6±21.8 °C |
|---|
Names
| Name | 4-ethoxynaphthalene-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 447.8±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO6 |
|---|
| Molecular Weight | 259.256 |
|---|
| Flash Point | 224.6±21.8 °C |
|---|
| Exact Mass | 259.105591 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 0.59 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | AOKDTARDWHVNDE-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(C(=O)O)c2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Propanedioic acid, 2-[1-[(1,1-dimethylethoxy)carbonyl]-3-azetidinyl]- |
| 4-Ethoxy-1-naphthalenecarboxylic acid |
| 4-Aethoxy-[1]naphthoesaeure |
| 4-ethoxy-[1]naphthoic acid |
| 4-Ethoxy-1-carboxy-naphthalin |
| (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinyl)malonic acid |
| 4-Ethoxy-<1>naphthoesaeure |
| 4-Ethoxynaphthalene-1-Carboxylic Acid |
| 4-ethoxy-1-naphthoic acid |
