Introduction：Basic information about CAS 213130-43-9|3-Chloro-4-cyano-benzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-cyano-benzenesulfonyl chloride |
|---|
| CAS Number | 213130-43-9 | Molecular Weight | 236.07500 |
|---|
| Density | 1.65g/cm3 | Boiling Point | 381.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl2NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.3ºC |
|---|
Names
| Name | 3-Chloro-4-cyanobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65g/cm3 |
|---|
| Boiling Point | 381.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl2NO2S |
|---|
| Molecular Weight | 236.07500 |
|---|
| Flash Point | 184.3ºC |
|---|
| Exact Mass | 234.92600 |
|---|
| PSA | 66.31000 |
|---|
| LogP | 3.21998 |
|---|
| Vapour Pressure | 5.19E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | HWCNCOCJCVWMBX-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(S(=O)(=O)Cl)cc1Cl |
|---|
Synonyms
| Benzenesulfonyl chloride,3-chloro-4-cyano |
| 2-chloro-4-(chlorosulfonyl)benzonitrile |
| 3-chloro-4-cyano-benzenesulfonyl chloride |
