Introduction：Basic information about CAS 214476-07-0|3-Quinolinecarbonitrile,7-ethoxy-4-hydroxy-(9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Quinolinecarbonitrile,7-ethoxy-4-hydroxy-(9CI) |
|---|
| CAS Number | 214476-07-0 | Molecular Weight | 214.22000 |
|---|
| Density | 1.282g/cm3 | Boiling Point | 363.261ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.494ºC |
|---|
Names
| Name | 7-Ethoxy-4-oxo-1,4-dihydro-3-quinolinecarbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.282g/cm3 |
|---|
| Boiling Point | 363.261ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O2 |
|---|
| Molecular Weight | 214.22000 |
|---|
| Flash Point | 173.494ºC |
|---|
| Exact Mass | 214.07400 |
|---|
| PSA | 65.88000 |
|---|
| LogP | 1.79848 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | KCRWFINJQDRSKE-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc2c(=O)c(C#N)c[nH]c2c1 |
|---|
Synonyms
| 7-ethoxy-4-hydroxy-quinoline-3-carbonitrile |
| 7-ethoxy-4'-hydroxyisoflavone |
| 4H-1-Benzopyran-4-one,7-ethoxy-3-(4-hydroxyphenyl) |
| 3-(4-hydroxyphenyl)-7-ethoxychromen-4-one |
| 7-O-ethyl-daidzein |
