Introduction：Basic information about CAS 145356-32-7|4-hydroxy Xylazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-hydroxy Xylazine |
|---|
| CAS Number | 145356-32-7 | Molecular Weight | 236.333 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 391.7±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H16N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.7±30.7 °C |
|---|
Names
| Name | 4-(5,6-Dihydro-4H-1,3-thiazin-2-ylamino)-3,5-dimethylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 391.7±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H16N2OS |
|---|
| Molecular Weight | 236.333 |
|---|
| Flash Point | 190.7±30.7 °C |
|---|
| Exact Mass | 236.098328 |
|---|
| PSA | 69.92000 |
|---|
| LogP | 1.63 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | FXWQWFCVDXMJNM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(O)cc(C)c1NC1=NCCCS1 |
|---|
Synonyms
| p-Hydroxyxylazine |
| 4-(5,6-Dihydro-4H-1,3-thiazin-2-ylamino)-3,5-dimethylphenol |
| Phenol, 4-[(5,6-dihydro-4H-1,3-thiazin-2-yl)amino]-3,5-dimethyl- |
| 4-Hydroxy Xylazine |
