Introduction：Basic information about CAS 124211-72-9|Ethanone, 2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone, 2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]- (9CI) |
|---|
| CAS Number | 124211-72-9 | Molecular Weight | 216.20000 |
|---|
| Density | 1.153g/cm3 | Boiling Point | 240.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H11F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115.1ºC |
|---|
Names
| Name | 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.153g/cm3 |
|---|
| Boiling Point | 240.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H11F3O |
|---|
| Molecular Weight | 216.20000 |
|---|
| Flash Point | 115.1ºC |
|---|
| Exact Mass | 216.07600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.55500 |
|---|
| Vapour Pressure | 0.0381mmHg at 25°C |
|---|
| Index of Refraction | 1.455 |
|---|
| InChIKey | JXAARZPBEHNXIL-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(C(=O)C(F)(F)F)cc1 |
|---|
Synonyms
| 4'-iso-Propyl-2,2,2-trifluoroacetophenone |
| Trifluoromethyl p-isopropylphenyl ketone |
| Ethanone,2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl] |
| 2,2,2-trifluoro-1-(4-isopropylphenyl)ethanone |
