Introduction：Basic information about CAS 117523-47-4|N-[1-(2-phenylethyl)piperidin-4-yl]-N-pyrazin-2-ylfuran-2-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[1-(2-phenylethyl)piperidin-4-yl]-N-pyrazin-2-ylfuran-2-carboxamide |
|---|
| CAS Number | 117523-47-4 | Molecular Weight | 376.45200 |
|---|
| Density | 1.222g/cm3 | Boiling Point | 538.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H24N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.3ºC |
|---|
Names
| Name | N-[1-(2-phenylethyl)piperidin-4-yl]-N-pyrazin-2-ylfuran-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.222g/cm3 |
|---|
| Boiling Point | 538.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H24N4O2 |
|---|
| Molecular Weight | 376.45200 |
|---|
| Flash Point | 279.3ºC |
|---|
| Exact Mass | 376.19000 |
|---|
| PSA | 62.47000 |
|---|
| LogP | 3.36140 |
|---|
| Vapour Pressure | 1.17E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | BJZZDOLVVLWFHN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccco1)N(c1cnccn1)C1CCN(CCc2ccccc2)CC1 |
|---|
Synonyms
| Mirfentanilum |
| Mirfentanilum [INN-Latin] |
| N-(2-pyrazinyl)-N-(1-phenethyl)-4-piperidinyl-2-furamide |
| Mirfentanil [INN] |
| Mirfentanilo [INN-Spanish] |
| Mirfentanil |
| Mirfentanilo |
