Introduction：Basic information about CAS 121-48-2|3,5-disulphobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-disulphobenzoic acid |
|---|
| CAS Number | 121-48-2 | Molecular Weight | 282.24800 |
|---|
| Density | 1.913g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6O8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5-Disulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.913g/cm3 |
|---|
| Molecular Formula | C7H6O8S2 |
|---|
| Molecular Weight | 282.24800 |
|---|
| Exact Mass | 281.95000 |
|---|
| PSA | 162.80000 |
|---|
| LogP | 2.03980 |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | LZRAAMHXKXNHEF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-disulphobenzoic acid |
| 3,5-Disulfobenzoicacid |
| 3,5-disulfonicbenzoic acid |
| 3.5-Disulfo-benzoesaeure |
| EINECS 204-474-1 |
| Benzoesaeure-disulfonsaeure-(3.5) |
| Benzoic acid,3,5-disulfo |
