Introduction：Basic information about CAS 146773-33-3|7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-AMINO-4-(2,5,8-TRIOXANONYL)COUMARIN |
|---|
| CAS Number | 146773-33-3 | Molecular Weight | 293.31500 |
|---|
| Density | 1.221g/cm3 | Boiling Point | 474.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19NO5 | Melting Point | 114-116ºC |
|---|
| MSDS | / | Flash Point | 218.5ºC |
|---|
Names
| Name | 7-Amino-4-{[2-(2-methoxyethoxy)ethoxy]methyl}-2H-chromen-2-one |
|---|
Chemical & Physical Properties
| Density | 1.221g/cm3 |
|---|
| Boiling Point | 474.2ºC at 760 mmHg |
|---|
| Melting Point | 114-116ºC |
|---|
| Molecular Formula | C15H19NO5 |
|---|
| Molecular Weight | 293.31500 |
|---|
| Flash Point | 218.5ºC |
|---|
| Exact Mass | 293.12600 |
|---|
| PSA | 83.92000 |
|---|
| LogP | 2.13600 |
|---|
| Vapour Pressure | 3.7E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | WDUHFRHYZNNRGQ-UHFFFAOYSA-N |
|---|
| SMILES | COCCOCCOCc1cc(=O)oc2cc(N)ccc12 |
|---|
Safety Information
| Safety Phrases | 22-24/25 |
|---|
| WGK Germany | 3 |
|---|
