Introduction：Basic information about CAS 84233-61-4|Nesosteine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nesosteine |
|---|
| CAS Number | 84233-61-4 | Molecular Weight | 237.27500 |
|---|
| Density | 1.405g/cm3 | Boiling Point | 486.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.9ºC |
|---|
Names
| Name | 2-(1,3-thiazolidine-3-carbonyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.405g/cm3 |
|---|
| Boiling Point | 486.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO3S |
|---|
| Molecular Weight | 237.27500 |
|---|
| Flash Point | 247.9ºC |
|---|
| Exact Mass | 237.04600 |
|---|
| PSA | 82.91000 |
|---|
| LogP | 1.46920 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | XVAYJUBRRZOANH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)N1CCSC1 |
|---|
Synonyms
| Nesosteina |
| Nesosoteinum |
| Nesosteine |
| Nesosteinum |
