Introduction：Basic information about CAS 59897-92-6|ethyl 4,6,6-trichloro-3,3-dimethyl-hex-5-enoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4,6,6-trichloro-3,3-dimethyl-hex-5-enoate |
|---|
| CAS Number | 59897-92-6 | Molecular Weight | 273.58400 |
|---|
| Density | 1.215g/cm3 | Boiling Point | 306.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H15Cl3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 112.2ºC |
|---|
Names
| Name | Ethyl 4,6,6-trichloro-3,3-dimethyl-5-hexenoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.215g/cm3 |
|---|
| Boiling Point | 306.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H15Cl3O2 |
|---|
| Molecular Weight | 273.58400 |
|---|
| Flash Point | 112.2ºC |
|---|
| Exact Mass | 272.01400 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.89220 |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | PIUGWHOPZWEXQQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(C)(C)C(Cl)C=C(Cl)Cl |
|---|
Synonyms
| Ethyl 3,3-Dimethyl-4,6,6-trichlor-5-hexenoat |
| 3,3-dimethyl-4,6,6-trichloro-5-hexenoic acid ethyl ester |
| ethyl 3,3-dimethyl-4,6,6-trichloro-5-hexenoate |
| 3,3-dimethyl-1-pyrazoline |
| 3,3-Dimethyl-pyrazolin-1 |
| 3H-Pyrazole,4,5-dihydro-3,3-dimethyl |
| 3,3-dimethyl-4,5-dihydro-3H-pyrazole |
| 4,6,6-Trichlor-3,3-dimethyl-5-hexensaeure-ethylester |
| 3,3-Dimethyl-1-pyrazolin |
