Introduction：Basic information about CAS 70458-93-4|ethyl 7-chloro-6-fluoro-4-hydroxyquinoline-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 7-chloro-6-fluoro-4-hydroxyquinoline-3-carboxylate |
|---|
| CAS Number | 70458-93-4 | Molecular Weight | 269.65600 |
|---|
| Density | 1.416g/cm3 | Boiling Point | 384.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClFNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.4ºC |
|---|
Names
| Name | ethyl 7-chloro-6-fluoro-4-oxo-1H-quinoline-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.416g/cm3 |
|---|
| Boiling Point | 384.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClFNO3 |
|---|
| Molecular Weight | 269.65600 |
|---|
| Flash Point | 186.4ºC |
|---|
| Exact Mass | 269.02500 |
|---|
| PSA | 59.16000 |
|---|
| LogP | 2.49730 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | VLOYRWBXBBOLJW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c[nH]c2cc(Cl)c(F)cc2c1=O |
|---|
Synonyms
| 7-chloro-3-ethoxycarbonyl-6-fluoro-4-hydroxyquinoline |
| 7-chloro-6-fluoro-4-hydroxyquinoline-3-carboxylic acid |
| 7-chloro-6-fluoro-4-hydroxyquinoline-3-carboxylic acid ethyl ester |
| Ethyl 7-chloro-6-fluoro-4-hydroxyquinoline-3-carboxylate |
| 7-Chloro-6-fluoro-4-hydroxy-3-quinolinecarboxylic acid ethyl ester |
