Introduction：Basic information about CAS 193482-31-4|2-Fluoro-2-methyl-3-oxo-3-phenyl-propionic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-2-methyl-3-oxo-3-phenyl-propionic acid ethyl ester |
|---|
| CAS Number | 193482-31-4 | Molecular Weight | 224.22800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H13FO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethyl 2-fluoro-2-methyl-3-oxo-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H13FO3 |
|---|
| Molecular Weight | 224.22800 |
|---|
| Exact Mass | 224.08500 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.16060 |
|---|
| InChIKey | OFSFPYILRKIMON-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)(F)C(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2-fluoro-2-methyl-3-oxo-3-phenylpropanoic acid ethyl ester |
| 2-fluoro-2-methyl-3-oxo-3-phenylpropionic acid ethyl ester |
| Ethyl2-Methyl-2-fluoro-3-oxo-3-phenylpropanoate |
| Ethyl a-fluoro-a-methylbenzoylacetate |
| Benzenepropanoic acid,a-fluoro-a-methyl-b-oxo-,ethyl ester |
| ethyl (2R)-2-fluoro-2-methyl-3-oxo-3-phenylpropanoate |
