Introduction：Basic information about CAS 54063-39-7|Fenetradil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fenetradil |
|---|
| CAS Number | 54063-39-7 | Molecular Weight | 376.53300 |
|---|
| Density | 1.026g/cm3 | Boiling Point | 462.6ºC at 760mmHg |
|---|
| Molecular Formula | C22H36N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.6ºC |
|---|
Names
| Name | 1-Isobutoxy-3-(4-methyl-1-piperazinyl)-2-propanyl 2-phenylbutanoa te |
|---|
Chemical & Physical Properties
| Density | 1.026g/cm3 |
|---|
| Boiling Point | 462.6ºC at 760mmHg |
|---|
| Molecular Formula | C22H36N2O3 |
|---|
| Molecular Weight | 376.53300 |
|---|
| Flash Point | 233.6ºC |
|---|
| Exact Mass | 376.27300 |
|---|
| PSA | 42.01000 |
|---|
| LogP | 2.88780 |
|---|
| Index of Refraction | 1.507 |
|---|
| InChIKey | JAHOJXDGNNONSL-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C(=O)OC(COCC(C)C)CN1CCN(C)CC1)c1ccccc1 |
|---|
