Introduction：Basic information about CAS 57548-79-5|Picafibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Picafibrate |
|---|
| CAS Number | 57548-79-5 | Molecular Weight | 362.80700 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 568.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19ClN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.9ºC |
|---|
Names
| Name | 2-(pyridine-3-carbonylamino)ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 568.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19ClN2O4 |
|---|
| Molecular Weight | 362.80700 |
|---|
| Flash Point | 297.9ºC |
|---|
| Exact Mass | 362.10300 |
|---|
| PSA | 81.01000 |
|---|
| LogP | 3.44040 |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | MCECKJXCBZXVJI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCNC(=O)c1cccnc1 |
|---|
Synonyms
| Picafibrato |
| Picafibrate |
| 2-((3-pyridinylcarbonyl)amino)ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| Picafibratum |
| Picafibratum [INN-Latin] |
| Picafibrato [INN-Spanish] |
