Introduction：Basic information about CAS 83059-56-7|Zabicipril, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zabicipril |
|---|
| CAS Number | 83059-56-7 | Molecular Weight | 416.51100 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 616.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H32N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.4ºC |
|---|
Names
| Name | (3S)-2-{N-[(2S)-1-Ethoxy-1-oxo-4-phenyl-2-butanyl]-L-alanyl}-2-az abicyclo[2.2.2]octane-3-carboxylic acid |
|---|
Zabicipril BiologicalActivity
| Description | Zabicipril HCl（S 9650） is a potent angiotensin-converting enzyme inhibitor. |
|---|
| References | 1. Lelievre E,,et al. Radioimmunoassays for a new angiotensin-converting enzyme inhibitor, zabicipril, and its active metabolite, zabiciprilat, in human plasma. J Pharm Sci. 1992 Nov;81(11):1065-70. |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 616.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H32N2O5 |
|---|
| Molecular Weight | 416.51100 |
|---|
| Flash Point | 326.4ºC |
|---|
| Exact Mass | 416.23100 |
|---|
| PSA | 95.94000 |
|---|
| LogP | 2.71200 |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | OMGPCTGQLHHVDU-SSXGPBTGSA-N |
|---|
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1C2CCC(CC2)C1C(=O)O |
|---|
