Introduction:Basic information about CAS 110771-95-4|1-[(4-Methylphenyl)Sulfonyl]Proline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(4-Methylphenyl)Sulfonyl]Proline |
|---|
| CAS Number | 110771-95-4 | Molecular Weight | 269.31700 |
|---|
| Density | 1.4±0.1g/cm3 | Boiling Point | 467.6±55.0°C at 760 mmHg |
|---|
| Molecular Formula | C12H15NO4S | Melting Point | 55-60 °C |
|---|
| MSDS | / | Flash Point | 236.6±31.5°C |
|---|
Names
| Name | (2R)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1g/cm3 |
|---|
| Boiling Point | 467.6±55.0°C at 760 mmHg |
|---|
| Melting Point | 55-60 °C |
|---|
| Molecular Formula | C12H15NO4S |
|---|
| Molecular Weight | 269.31700 |
|---|
| Flash Point | 236.6±31.5°C |
|---|
| Exact Mass | 269.07200 |
|---|
| PSA | 83.06000 |
|---|
| LogP | 2.25140 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | CGPHGPCHVUSFFA-LLVKDONJSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)O)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| TPR |
| N-4-toluenesulfonyl-L-proline |
| TOSYL-D-PROLINE |
| N-(toluene-4-sulfonyl)-L-proline |
| p-methylphenylsulfonyl-L-proline |
| (S)-N-p-toluenesulfonylproline |
| 1-tosyl-L-proline |
| (S)-1-(4-toluenesulfonyl)pyrrolidine-2-carboxylic acid |
| N-p-toluenesulfonyl-L-proline |
| 1f4e |
| 1-[(4-Methylphenyl)Sulfonyl]Proline |
| Tos-D-Pro-OH |