Introduction:Basic information about CAS 1173021-97-0|acetic acid,(6E)-4-fluoro-6-(2-phenyl-1H-pyrazol-3-ylidene)cyclohexa-2,4-dien-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | acetic acid,(6E)-4-fluoro-6-(2-phenyl-1H-pyrazol-3-ylidene)cyclohexa-2,4-dien-1-one |
|---|
| CAS Number | 1173021-97-0 | Molecular Weight | 314.31100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C17H15FN2O3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | acetic acid,(6E)-4-fluoro-6-(2-phenyl-1H-pyrazol-3-ylidene)cyclohexa-2,4-dien-1-one |
|---|
Chemical & Physical Properties
| Molecular Formula | C17H15FN2O3 |
|---|
| Molecular Weight | 314.31100 |
|---|
| Exact Mass | 314.10700 |
|---|
| PSA | 75.09000 |
|---|
| LogP | 2.32040 |
|---|
| InChIKey | FMBSJGKYPDHBCU-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccc(F)cc1-c1ccnn1-c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| RIDADR | NONH for all modes of transport |
|---|