Introduction:Basic information about CAS 124620-51-5|(S)-tert-Butyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-tert-Butyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate |
|---|
| CAS Number | 124620-51-5 | Molecular Weight | 323.38400 |
|---|
| Density | 1.137 g/cm3 | Boiling Point | 475.67ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 241.477ºC |
|---|
Names
| Name | tert-butyl (2S)-5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.137 g/cm3 |
|---|
| Boiling Point | 475.67ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25NO5 |
|---|
| Molecular Weight | 323.38400 |
|---|
| Flash Point | 241.477ºC |
|---|
| Exact Mass | 323.17300 |
|---|
| PSA | 84.86000 |
|---|
| LogP | 2.78650 |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | WNQJOTOXDQAJLI-AWEZNQCLSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)C(CCCO)NC(=O)OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-benzyloxycarbonylamino-5-hydroxy-pentanoic acid tert-butyl ester |
| AC-7896 |
| tert-butyl (S)-2-(benzyloxycarbonylamino)-5-hydroxypentanoate |
| tert-butyl (2S)-5-hydroxy-2-(benzyloxycarbonylamino)pentanoate |
| tert-butyl (S)-2-(N-benzyloxycarbonylamino)-5-hydroxyvalerate |
| N2-(benzyloxycarbonyl)-5-hydroxy-L-norvaline 1-tert-butyl ester |
| L-Norvaline,5-hydroxy-N-[(phenylmethoxy)carbonyl]-,1,1-dimethylethyl ester |
| (S)-tert-butyl 2-(((benzyloxy)carbonyl)amino)-5-hydroxypentanoate |
| (S)-tert-butyl 2-(benzyloxycarbonylamino)-5-hydroxypentanoate |