Introduction:Basic information about CAS 125617-94-9|iralukast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | iralukast |
|---|
| CAS Number | 125617-94-9 | Molecular Weight | 732.73800 |
|---|
| Density | / | Boiling Point | 820.9ºC at 760mmHg |
|---|
| Molecular Formula | C38H36F3NaO8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 450.3ºC |
|---|
Names
| Name | sodium,7-[(1R,2S,3E,5Z)-10-(4-acetyl-3-hydroxy-2-propylphenoxy)-1-hydroxy-1-[3-(trifluoromethyl)phenyl]deca-3,5-dien-2-yl]sulfanyl-4-oxochromene-2-carboxylate |
|---|
Chemical & Physical Properties
| Boiling Point | 820.9ºC at 760mmHg |
|---|
| Molecular Formula | C38H36F3NaO8S |
|---|
| Molecular Weight | 732.73800 |
|---|
| Flash Point | 450.3ºC |
|---|
| Exact Mass | 732.19800 |
|---|
| PSA | 162.40000 |
|---|
| LogP | 9.36490 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | UVMDAJYLEKEIPJ-RWRWEHELSA-M |
|---|
| SMILES | CCCc1c(OCCCCC=CC=CC(Sc2ccc3c(=O)cc(C(=O)[O-])oc3c2)C(O)c2cccc(C(F)(F)F)c2)ccc(C(C)=O)c1O.[Na+] |
|---|