Introduction:Basic information about CAS 14048-58-9|2-METHYL-5-(1,2,3,4-TETRAHYDROXYBUTYL)-3-FUROIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-METHYL-5-(1,2,3,4-TETRAHYDROXYBUTYL)-3-FUROIC ACID |
|---|
| CAS Number | 14048-58-9 | Molecular Weight | 246.21400 |
|---|
| Density | / | Boiling Point | 584ºC at 760mmHg |
|---|
| Molecular Formula | C10H14O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 307ºC |
|---|
Names
| Name | 2-methyl-5-(1,2,3,4-tetrahydroxybutyl)furan-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 584ºC at 760mmHg |
|---|
| Molecular Formula | C10H14O7 |
|---|
| Molecular Weight | 246.21400 |
|---|
| Flash Point | 307ºC |
|---|
| Exact Mass | 246.07400 |
|---|
| PSA | 131.36000 |
|---|
| Vapour Pressure | 1.76E-14mmHg at 25°C |
|---|
| InChIKey | QCJQVLKXEYQMLF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1oc(C(O)C(O)C(O)CO)cc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-methyl-5-(1,2,3,4-tetrahydroxybutyl)-3-furoic acid |
| HMS1783H16 |
| 2-Methyl-5-<D-arabino-1,2,3,4-tetrahydroxy-butyl>-3-carbonsaeure |
| 5-(D-arabino-tetroxybutyl)-3-methyl-furoic acid |
| 2-methyl-5-(Dr-1tF,2cF,3rF,4-tetrahydroxy-but-catF-yl)-furan-3-carboxylic acid |
| 2-Methyl-5-(d-arabo-tetraoxybutyl)-furan-carbonsaeure-(3) |
| 2-Methyl-5-(Dr-1tF,2cF,3rF,4-tetrahydroxy-but-catF-yl)-furan-3-carbonsaeure |