Introduction:Basic information about CAS 14071-35-3|N-[5-[bis(2-hydroxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[5-[bis(2-hydroxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamide |
|---|
| CAS Number | 14071-35-3 | Molecular Weight | 491.29500 |
|---|
| Density | 1.57g/cm3 | Boiling Point | 795.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19BrN6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 435.1ºC |
|---|
Names
| Name | N-[5-[bis(2-hydroxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Boiling Point | 795.9ºC at 760 mmHg |
|---|
| Molecular Formula | C19H19BrN6O5 |
|---|
| Molecular Weight | 491.29500 |
|---|
| Flash Point | 435.1ºC |
|---|
| Exact Mass | 490.06000 |
|---|
| PSA | 170.62000 |
|---|
| LogP | 4.56648 |
|---|
| Vapour Pressure | 1.02E-26mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | TZGRVPGNUHVFOB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cc(N(CCO)CCO)ccc1N=Nc1c(Br)cc([N+](=O)[O-])cc1C#N |
|---|
Synonyms
| N-(5-(bis(2-hydroxyethyl)amino)-2-((2-bromo-6-cyano-4-nitrophenyl)diazenyl)phenyl)-acetamide |
| Acetamide,N-(5-(bis(2-hydroxyethyl)amino)-2-(2-(2-bromo-6-cyano-4-nitrophenyl)diazenyl)phenyl) |
| n-{5-[bis(2-hydroxyethyl)amino]-2-[(e)-(2-bromo-6-cyano-4-nitrophenyl)diazenyl]phenyl}acetamide |
| N-(5-(Bis(2-hydroxyethyl)amino)-2-((2-bromo-6-cyano-4-nitrophenyl)azo)phenyl)acetamide |
| Acetamide,N-(5-(bis(2-hydroxyethyl)amino)-2-((2-bromo-6-cyano-4-nitrophenyl)azo)phenyl) |