Introduction:Basic information about CAS 190781-29-4|Benzamide,3,4,5-trihydroxy-N-propyl- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,3,4,5-trihydroxy-N-propyl- (9CI) |
|---|
| CAS Number | 190781-29-4 | Molecular Weight | 211.214 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 393.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.9±27.9 °C |
|---|
Names
| Name | 3,4,5-trihydroxy-N-propylbenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 393.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13NO4 |
|---|
| Molecular Weight | 211.214 |
|---|
| Flash Point | 191.9±27.9 °C |
|---|
| Exact Mass | 211.084457 |
|---|
| PSA | 93.28000 |
|---|
| LogP | 1.14 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | PBOQNHCRSUQSCP-UHFFFAOYSA-N |
|---|
| SMILES | CCCNC(=O)c1cc(O)c(O)c(O)c1 |
|---|
Synonyms
| Benzamide,3,4,5-trihydroxy-N-propyl |
| 3,4,5-Trihydroxy-N-propylbenzamide |
| Benzamide, 3,4,5-trihydroxy-N-propyl- |
| Benzamide,3,4,5-trihydroxy-N-propyl-(9CI) |
| Benzamide,3,4,5-trihydroxy-N-propyl- (9CI) |