Introduction：Basic information about CAS 1948-82-9|1-oxopropane-1,2,3-tricarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-oxopropane-1,2,3-tricarboxylic acid |
|---|
| CAS Number | 1948-82-9 | Molecular Weight | 190.10800 |
|---|
| Density | 1.744g/cm3 | Boiling Point | 380.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H6O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.1ºC |
|---|
Names
| Name | oxalosuccinic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.744g/cm3 |
|---|
| Boiling Point | 380.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H6O7 |
|---|
| Molecular Weight | 190.10800 |
|---|
| Flash Point | 198.1ºC |
|---|
| Exact Mass | 190.01100 |
|---|
| PSA | 128.97000 |
|---|
| Vapour Pressure | 7.68E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | UFSCUAXLTRFIDC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(C(=O)O)C(=O)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Oxalylbernsteinsaeure |
| oxalosuccinate |
| Oxalbernsteinsaeure |
| 1-Oxo-propan-1,2,3-tricarbonsaeure |
| 1-oxopropane-1,2,3-tricarboxylic acid |
| Oxalosuccinicacid (6CI) |
| 2-Oxalosuccinic Acid |
| 1-oxo-propane-1,2,3-tricarboxylic acid |
| Oxalosuccinic acid |
| 1-oxopropane-1,2,3-tricarboxylate |
