Introduction：Basic information about CAS 194870-66-1|Propanoic acid-4,5-difluoro-1H-indole (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanoic acid-4,5-difluoro-1H-indole (1:1) |
|---|
| CAS Number | 194870-66-1 | Molecular Weight | 227.207 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H11F2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,5-difluoro-1H-indole,propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H11F2NO2 |
|---|
| Molecular Weight | 227.207 |
|---|
| Exact Mass | 227.075790 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 2.92710 |
|---|
| InChIKey | MKPIGDPELRNWBB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc2c(F)c(F)ccc2[nH]1 |
|---|
Synonyms
| Propanoic acid - 4,5-difluoro-1H-indole (1:1) |
| ethyl 4,5-difluoroindole-2-carboxylate |
| 4,5-Difluoroindole-2-ethylcarboxylate |
| ethyl 4,5-difluoro-1H-indole-2-carboxylate |
| 4,5-bis(fluoranyl)-1H-indole |
| Propanoic acid, compd. with 4,5-difluoro-1H-indole (1:1) |
| Propanoic Acid-4,5-Difluoro-1H-Indole |
