Introduction：Basic information about CAS 141123-11-7|2-(4-chloro-3-methylbenzoyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-chloro-3-methylbenzoyl)benzoic acid |
|---|
| CAS Number | 141123-11-7 | Molecular Weight | 274.69900 |
|---|
| Density | 1.318g/cm3 | Boiling Point | 485.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.2ºC |
|---|
Names
| Name | 2-(4-chloro-3-methylbenzoyl)benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.318g/cm3 |
|---|
| Boiling Point | 485.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11ClO3 |
|---|
| Molecular Weight | 274.69900 |
|---|
| Flash Point | 247.2ºC |
|---|
| Exact Mass | 274.04000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.57760 |
|---|
| Vapour Pressure | 3.18E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | XNHZUUJHQSXXIJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)c2ccccc2C(=O)O)ccc1Cl |
|---|
