Introduction：Basic information about CAS 57477-98-2|ethyl 3-(4-biphenyl)-3-oxopropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 3-(4-biphenyl)-3-oxopropanoate |
|---|
| CAS Number | 57477-98-2 | Molecular Weight | 268.307 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 391.8±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.1±21.0 °C |
|---|
Names
| Name | ethyl 3-oxo-3-(4-phenylphenyl)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 391.8±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16O3 |
|---|
| Molecular Weight | 268.307 |
|---|
| Flash Point | 172.1±21.0 °C |
|---|
| Exact Mass | 268.109955 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | MJCRLYUYIXGGAX-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)c1ccc(-c2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| ethyl 3-(4-biphenyl)-3-oxopropanoate |
| AC-7797 |
| ethyl 4-phenylbenzoylacetate |
| Ethyl 3-(4-biphenylyl)-3-oxopropanoate |
| b-Oxo-biphenyl-4-propanoic acid ethyl ester |
| Ethyl 3-(biphenyl-4-yl)-3-oxopropanoate |
| [1,1'-Biphenyl]-4-propanoic acid, β-oxo-, ethyl ester |
| 3-Biphenyl-4-yl-3-oxopropionic acid ethyl ester |
